C22H28N2O4 — CID 102096047
N,N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]butanediamide (PubChem CID 102096047) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N,N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]butanediamide.
| Compound Name | N,N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]butanediamide |
|---|---|
| PubChem CID | 102096047 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N,N'-bis[(2S)-1-hydroxy-3-phenylpropan-2-yl]butanediamide |
| SMILES | O=C(CCC(=O)N[C@H](CO)Cc1ccccc1)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O4/c25-15-19(13-17-7-3-1-4-8-17)23-21(27)11-12-22(28)24-20(16-26)14-18-9-5-2-6-10-18/h1-10,19-20,25-26H,11-16H2,(H,23,27)(H,24,28)/t19-,20-/m0/s1 |
| InChIKey | NAOJZKZJLUKERY-PMACEKPBSA-N |
| XLogP | 1.21 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |