C16H23NO5 — CID 156622371
2-methoxyethyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-oxobutanoate (PubChem CID 156622371) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 156622371 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-methoxyethyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C16H23NO5/c1-21-9-10-22-16(20)8-7-15(19)17-14(12-18)11-13-5-3-2-4-6-13/h2-6,14,18H,7-12H2,1H3,(H,17,19) |
| InChIKey | MZWGHACOGIGFKG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|