C26H37NO10 — CID 157408186
2-methoxyethyl 4-[[1-[2-[2-(2-methylpropanoyloxy)propanoyloxy]propanoyloxy]-3-phenylpropan-2-yl]amino]-4-oxobutanoate (PubChem CID 157408186) has the molecular formula C26H37NO10 and a molecular weight of 523.58 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[1-[2-[2-(2-methylpropanoyloxy)propanoyloxy]propanoyloxy]-3-phenylpropan-2-yl]amino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[[1-[2-[2-(2-methylpropanoyloxy)propanoyloxy]propanoyloxy]-3-phenylpropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 157408186 |
| Molecular Formula | C26H37NO10 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 2-methoxyethyl 4-[[1-[2-[2-(2-methylpropanoyloxy)propanoyloxy]propanoyloxy]-3-phenylpropan-2-yl]amino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(COC(=O)C(C)OC(=O)C(C)OC(=O)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C26H37NO10/c1-17(2)24(30)36-19(4)26(32)37-18(3)25(31)35-16-21(15-20-9-7-6-8-10-20)27-22(28)11-12-23(29)34-14-13-33-5/h6-10,17-19,21H,11-16H2,1-5H3,(H,27,28) |
| InChIKey | OGIJTNHMSJNKDX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|