C23H32N2O5 — CID 6605307
2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl pent-4-enoate (PubChem CID 6605307) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl pent-4-enoate.
| Compound Name | 2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl pent-4-enoate |
|---|---|
| PubChem CID | 6605307 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl pent-4-enoate |
| SMILES | C=CCCC(=O)OCCNC(=O)[C@H](CC=C)CC(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O5/c1-3-5-12-22(28)30-14-13-24-23(29)19(9-4-2)16-21(27)25-20(17-26)15-18-10-7-6-8-11-18/h3-4,6-8,10-11,19-20,26H,1-2,5,9,12-17H2,(H,24,29)(H,25,27)/t19-,20-/m1/s1 |
| InChIKey | PZOKGKWPTZYMOZ-WOJBJXKFSA-N |
| XLogP | 1.91 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|