C38H46N2O6 — CID 122404812
2-[[(2S)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2R)-2-benzylhex-5-enoate (PubChem CID 122404812) has the molecular formula C38H46N2O6 and a molecular weight of 626.79 g/mol. Its IUPAC name is 2-[[(2S)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2R)-2-benzylhex-5-enoate.
| Compound Name | 2-[[(2S)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2R)-2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 122404812 |
| Molecular Formula | C38H46N2O6 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | 2-[[(2S)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2R)-2-benzylhex-5-enoate |
| SMILES | C=CCC[C@H](Cc1ccccc1)C(=O)OCCNC(=O)C(CC=C)CC(=O)N[C@H](CO)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H46N2O6/c1-3-5-17-33(24-29-13-8-6-9-14-29)38(44)45-23-22-39-37(43)32(12-4-2)26-36(42)40-34(27-41)25-30-18-20-35(21-19-30)46-28-31-15-10-7-11-16-31/h3-4,6-11,13-16,18-21,32-34,41H,1-2,5,12,17,22-28H2,(H,39,43)(H,40,42)/t32?,33-,34+/m1/s1 |
| InChIKey | GIOJWNSHWSXBRM-HDXMDBOXSA-N |
| XLogP | 5.35 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|