C25H32N2O5 — CID 122412442
(2S)-N-(2-hydroxyethyl)-N'-[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-prop-2-enylbutanediamide (PubChem CID 122412442) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (2S)-N-(2-hydroxyethyl)-N'-[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-prop-2-enylbutanediamide.
| Compound Name | (2S)-N-(2-hydroxyethyl)-N'-[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 122412442 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (2S)-N-(2-hydroxyethyl)-N'-[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(CC(=O)N[C@H](CO)Cc1ccc(OCc2ccccc2)cc1)C(=O)NCCO |
| InChI | InChI=1S/C25H32N2O5/c1-2-6-21(25(31)26-13-14-28)16-24(30)27-22(17-29)15-19-9-11-23(12-10-19)32-18-20-7-4-3-5-8-20/h2-5,7-12,21-22,28-29H,1,6,13-18H2,(H,26,31)(H,27,30)/t21?,22-/m0/s1 |
| InChIKey | DSURYEFICYTUQL-KEKNWZKVSA-N |
| XLogP | 1.98 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|