C38H46N2O6 — CID 6606580
[(2S)-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] hex-5-enoate (PubChem CID 6606580) has the molecular formula C38H46N2O6 and a molecular weight of 626.79 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] hex-5-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] hex-5-enoate |
|---|---|
| PubChem CID | 6606580 |
| Molecular Formula | C38H46N2O6 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)OC[C@H](Cc1ccccc1)NC(=O)[C@H](CC=C)CC(=O)N[C@H](CO)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H46N2O6/c1-3-5-8-18-37(43)46-28-34(24-29-14-9-6-10-15-29)40-38(44)32(13-4-2)25-36(42)39-33(26-41)23-30-19-21-35(22-20-30)45-27-31-16-11-7-12-17-31/h3-4,6-7,9-12,14-17,19-22,32-34,41H,1-2,5,8,13,18,23-28H2,(H,39,42)(H,40,44)/t32-,33+,34+/m1/s1 |
| InChIKey | DUIGXARBTNLERK-WKNISULPSA-N |
| XLogP | 5.49 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|