C43H49N3O7 — CID 4151074
[2-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] hept-6-enoate (PubChem CID 4151074) has the molecular formula C43H49N3O7 and a molecular weight of 719.88 g/mol. Its IUPAC name is [2-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] hept-6-enoate.
| Compound Name | [2-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] hept-6-enoate |
|---|---|
| PubChem CID | 4151074 |
| Molecular Formula | C43H49N3O7 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.36 |
| IUPAC Name | [2-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OCC(NC(=O)C(CC=C)CC(=O)NC(CO)Cc1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C43H49N3O7/c1-3-5-6-10-18-41(49)53-30-39(43(51)45-36-22-21-33-16-11-12-17-34(33)26-36)46-42(50)35(13-4-2)27-40(48)44-37(28-47)25-31-19-23-38(24-20-31)52-29-32-14-8-7-9-15-32/h3-4,7-9,11-12,14-17,19-24,26,35,37,39,47H,1-2,5-6,10,13,18,25,27-30H2,(H,44,48)(H,45,51)(H,46,50) |
| InChIKey | PZWCZBZBBFJPPR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|