C40H49N3O6 — CID 23307455
[(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-(naphthalen-2-ylamino)-3-oxopropyl] (2R)-2-benzylhept-6-enoate (PubChem CID 23307455) has the molecular formula C40H49N3O6 and a molecular weight of 667.85 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-(naphthalen-2-ylamino)-3-oxopropyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-(naphthalen-2-ylamino)-3-oxopropyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 23307455 |
| Molecular Formula | C40H49N3O6 |
| Molecular Weight | 667.85 g/mol |
| Exact Mass | 667.36 |
| IUPAC Name | [(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-(naphthalen-2-ylamino)-3-oxopropyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OC[C@H](NC(=O)[C@@H](CC=C)CC(=O)NC1(CO)CCCC1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C40H49N3O6/c1-3-5-7-19-33(24-29-15-8-6-9-16-29)39(48)49-27-35(38(47)41-34-21-20-30-17-10-11-18-31(30)25-34)42-37(46)32(14-4-2)26-36(45)43-40(28-44)22-12-13-23-40/h3-4,6,8-11,15-18,20-21,25,32-33,35,44H,1-2,5,7,12-14,19,22-24,26-28H2,(H,41,47)(H,42,46)(H,43,45)/t32-,33+,35-/m0/s1 |
| InChIKey | OSSDFOMPQRAJGY-UJNSZXMOSA-N |
| XLogP | 6.03 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|