C36H48N2O5 — CID 6607318
[(2R)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhept-6-enoate (PubChem CID 6607318) has the molecular formula C36H48N2O5 and a molecular weight of 588.79 g/mol. Its IUPAC name is [(2R)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(2R)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6607318 |
| Molecular Formula | C36H48N2O5 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | [(2R)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OC[C@@H](Cc1ccccc1)NC(=O)[C@H](CC=C)CC(=O)NC1(CO)CCCC1 |
| InChI | InChI=1S/C36H48N2O5/c1-3-5-8-20-31(23-28-16-9-6-10-17-28)35(42)43-26-32(24-29-18-11-7-12-19-29)37-34(41)30(15-4-2)25-33(40)38-36(27-39)21-13-14-22-36/h3-4,6-7,9-12,16-19,30-32,39H,1-2,5,8,13-15,20-27H2,(H,37,41)(H,38,40)/t30-,31-,32-/m1/s1 |
| InChIKey | UBAWPRQOZTVETH-XWHIBYANSA-N |
| XLogP | 5.48 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|