C35H46N2O5 — CID 135739356
[(1R)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate (PubChem CID 135739356) has the molecular formula C35H46N2O5 and a molecular weight of 574.76 g/mol. Its IUPAC name is [(1R)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(1R)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 135739356 |
| Molecular Formula | C35H46N2O5 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | [(1R)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)O[C@@H](CNC(=O)[C@@H](CC=C)CC(=O)NC1(CO)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C35H46N2O5/c1-3-5-8-20-30(23-27-16-9-6-10-17-27)34(41)42-31(28-18-11-7-12-19-28)25-36-33(40)29(15-4-2)24-32(39)37-35(26-38)21-13-14-22-35/h3-4,6-7,9-12,16-19,29-31,38H,1-2,5,8,13-15,20-26H2,(H,36,40)(H,37,39)/t29-,30+,31-/m0/s1 |
| InChIKey | GRQNBFLZMNOKOR-YPKYBTACSA-N |
| XLogP | 5.61 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|