C32H48N2O5 — CID 4048282
[2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate (PubChem CID 4048282) has the molecular formula C32H48N2O5 and a molecular weight of 540.75 g/mol. Its IUPAC name is [2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate.
| Compound Name | [2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 4048282 |
| Molecular Formula | C32H48N2O5 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | [2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate |
| SMILES | C=CCCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NC1(CO)CCCC1)C(C)C |
| InChI | InChI=1S/C32H48N2O5/c1-5-7-9-17-27(20-25-15-10-8-11-16-25)31(38)39-22-28(24(3)4)33-30(37)26(14-6-2)21-29(36)34-32(23-35)18-12-13-19-32/h5-6,8,10-11,15-16,24,26-28,35H,1-2,7,9,12-14,17-23H2,3-4H3,(H,33,37)(H,34,36) |
| InChIKey | NXJUDWXIFRUZSH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|