C33H48N2O5 — CID 135738868
[1-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate (PubChem CID 135738868) has the molecular formula C33H48N2O5 and a molecular weight of 552.76 g/mol. Its IUPAC name is [1-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate.
| Compound Name | [1-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 135738868 |
| Molecular Formula | C33H48N2O5 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | [1-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OCC1(NC(=O)[C@@H](CC=C)CC(=O)NC2(CO)CCCC2)CCCC1 |
| InChI | InChI=1S/C33H48N2O5/c1-3-5-7-17-28(22-26-15-8-6-9-16-26)31(39)40-25-33(20-12-13-21-33)35-30(38)27(14-4-2)23-29(37)34-32(24-36)18-10-11-19-32/h3-4,6,8-9,15-16,27-28,36H,1-2,5,7,10-14,17-25H2,(H,34,37)(H,35,38)/t27-,28+/m0/s1 |
| InChIKey | NFWCSHDTISEZJZ-WUFINQPMSA-N |
| XLogP | 5.18 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|