C43H54N2O6 — CID 4088412
[1-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]cyclopentyl]methyl 2-benzylhept-6-enoate (PubChem CID 4088412) has the molecular formula C43H54N2O6 and a molecular weight of 694.91 g/mol. Its IUPAC name is [1-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]cyclopentyl]methyl 2-benzylhept-6-enoate.
| Compound Name | [1-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]cyclopentyl]methyl 2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 4088412 |
| Molecular Formula | C43H54N2O6 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.40 |
| IUPAC Name | [1-[2-[2-[[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoylamino]cyclopentyl]methyl 2-benzylhept-6-enoate |
| SMILES | C=CCCCC(Cc1ccccc1)C(=O)OCC1(NC(=O)C(CC=C)CC(=O)NC(CO)Cc2ccc(OCc3ccccc3)cc2)CCCC1 |
| InChI | InChI=1S/C43H54N2O6/c1-3-5-8-20-37(27-33-16-9-6-10-17-33)42(49)51-32-43(25-13-14-26-43)45-41(48)36(15-4-2)29-40(47)44-38(30-46)28-34-21-23-39(24-22-34)50-31-35-18-11-7-12-19-35/h3-4,6-7,9-12,16-19,21-24,36-38,46H,1-2,5,8,13-15,20,25-32H2,(H,44,47)(H,45,48) |
| InChIKey | DEWSAIQATHOQBR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|