C45H58N2O6 — CID 6605364
[(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhex-5-enoate (PubChem CID 6605364) has the molecular formula C45H58N2O6 and a molecular weight of 722.97 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhex-5-enoate.
| Compound Name | [(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 6605364 |
| Molecular Formula | C45H58N2O6 |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 722.43 |
| IUPAC Name | [(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhex-5-enoate |
| SMILES | C=CCC[C@H](Cc1ccccc1)C(=O)OC[C@H](CC1CCCCC1)NC(=O)[C@H](CC=C)CC(=O)N[C@H](CO)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C45H58N2O6/c1-3-5-22-39(27-34-16-9-6-10-17-34)45(51)53-33-41(29-35-18-11-7-12-19-35)47-44(50)38(15-4-2)30-43(49)46-40(31-48)28-36-23-25-42(26-24-36)52-32-37-20-13-8-14-21-37/h3-4,6,8-10,13-14,16-17,20-21,23-26,35,38-41,48H,1-2,5,7,11-12,15,18-19,22,27-33H2,(H,46,49)(H,47,50)/t38-,39-,40+,41+/m1/s1 |
| InChIKey | YBAMRWRMLLOKSP-BHTPUMDESA-N |
| XLogP | 7.69 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|