C39H54N2O6 — CID 6606566
[(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate (PubChem CID 6606566) has the molecular formula C39H54N2O6 and a molecular weight of 646.87 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate.
| Compound Name | [(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate |
|---|---|
| PubChem CID | 6606566 |
| Molecular Formula | C39H54N2O6 |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | [(2S)-3-cyclohexyl-2-[[(2R)-2-[2-[[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@H](CC1CCCCC1)NC(=O)[C@H](CC=C)CC(=O)N[C@H](CO)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C39H54N2O6/c1-3-5-6-13-19-38(44)47-29-35(25-30-15-9-7-10-16-30)41-39(45)33(14-4-2)26-37(43)40-34(27-42)24-31-20-22-36(23-21-31)46-28-32-17-11-8-12-18-32/h3-4,8,11-12,17-18,20-23,30,33-35,42H,1-2,5-7,9-10,13-16,19,24-29H2,(H,40,43)(H,41,45)/t33-,34+,35+/m1/s1 |
| InChIKey | SIMZGTUFXHBOSK-PLJDCMBSSA-N |
| XLogP | 6.61 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|