C30H44N2O5 — CID 6606817
[1-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate (PubChem CID 6606817) has the molecular formula C30H44N2O5 and a molecular weight of 512.69 g/mol. Its IUPAC name is [1-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate.
| Compound Name | [1-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6606817 |
| Molecular Formula | C30H44N2O5 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | [1-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OCC1(NC(=O)[C@H](CC=C)CC(=O)N[C@H](C)CO)CCCC1 |
| InChI | InChI=1S/C30H44N2O5/c1-4-6-8-16-26(19-24-14-9-7-10-15-24)29(36)37-22-30(17-11-12-18-30)32-28(35)25(13-5-2)20-27(34)31-23(3)21-33/h4-5,7,9-10,14-15,23,25-26,33H,1-2,6,8,11-13,16-22H2,3H3,(H,31,34)(H,32,35)/t23-,25-,26-/m1/s1 |
| InChIKey | HKHQIERAUNBZFT-LGPLSSKUSA-N |
| XLogP | 4.25 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|