C28H42N2O5 — CID 135739182
[2-[[(2S)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] (2R)-2-benzylhept-6-enoate (PubChem CID 135739182) has the molecular formula C28H42N2O5 and a molecular weight of 486.65 g/mol. Its IUPAC name is [2-[[(2S)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [2-[[(2S)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 135739182 |
| Molecular Formula | C28H42N2O5 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | [2-[[(2S)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OCC(C)(C)NC(=O)[C@@H](CC=C)CC(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C28H42N2O5/c1-6-8-10-16-24(17-22-14-11-9-12-15-22)27(34)35-20-28(4,5)30-26(33)23(13-7-2)18-25(32)29-21(3)19-31/h6-7,9,11-12,14-15,21,23-24,31H,1-2,8,10,13,16-20H2,3-5H3,(H,29,32)(H,30,33)/t21-,23-,24+/m0/s1 |
| InChIKey | WGVOOCOVVRNJMI-OEMFJLHTSA-N |
| XLogP | 3.72 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|