C28H42N2O6 — CID 3599199
[2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-benzylhex-5-enoate (PubChem CID 3599199) has the molecular formula C28H42N2O6 and a molecular weight of 502.65 g/mol. Its IUPAC name is [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-benzylhex-5-enoate.
| Compound Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 3599199 |
| Molecular Formula | C28H42N2O6 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-benzylhex-5-enoate |
| SMILES | C=CCCC(Cc1ccccc1)C(=O)OCC(C)(C)NC(=O)C(CC=C)CC(=O)NCCOCCO |
| InChI | InChI=1S/C28H42N2O6/c1-5-7-14-24(19-22-12-9-8-10-13-22)27(34)36-21-28(3,4)30-26(33)23(11-6-2)20-25(32)29-15-17-35-18-16-31/h5-6,8-10,12-13,23-24,31H,1-2,7,11,14-21H2,3-4H3,(H,29,32)(H,30,33) |
| InChIKey | LIFGREBCBFWBAS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|