C26H38N2O6 — CID 6605988
[(2S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylpent-4-enoate (PubChem CID 6605988) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylpent-4-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 6605988 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylpent-4-enoate |
| SMILES | C=CC[C@H](CC(=O)NCCOCCO)C(=O)N[C@@H](C)COC(=O)[C@H](CC=C)Cc1ccccc1 |
| InChI | InChI=1S/C26H38N2O6/c1-4-9-22(18-24(30)27-13-15-33-16-14-29)25(31)28-20(3)19-34-26(32)23(10-5-2)17-21-11-7-6-8-12-21/h4-8,11-12,20,22-23,29H,1-2,9-10,13-19H2,3H3,(H,27,30)(H,28,31)/t20-,22+,23+/m0/s1 |
| InChIKey | YPTIGOFHFQGJBW-MDNUFGMLSA-N |
| XLogP | 2.18 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|