C32H42N2O6 — CID 3450394
[2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate (PubChem CID 3450394) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate.
| Compound Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 3450394 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate |
| SMILES | C=CCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NCCOCCO)c1ccccc1 |
| InChI | InChI=1S/C32H42N2O6/c1-3-5-15-28(22-25-13-8-6-9-14-25)32(38)40-24-29(26-16-10-7-11-17-26)34-31(37)27(12-4-2)23-30(36)33-18-20-39-21-19-35/h3-4,6-11,13-14,16-17,27-29,35H,1-2,5,12,15,18-24H2,(H,33,36)(H,34,37) |
| InChIKey | YNDPICKJSSGECX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|