C25H36N2O6 — CID 4151115
2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]ethyl 2-benzylpent-4-enoate (PubChem CID 4151115) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]ethyl 2-benzylpent-4-enoate.
| Compound Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]ethyl 2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 4151115 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]ethyl 2-benzylpent-4-enoate |
| SMILES | C=CCC(CC(=O)NCCOCCO)C(=O)NCCOC(=O)C(CC=C)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N2O6/c1-3-8-21(19-23(29)26-12-15-32-17-14-28)24(30)27-13-16-33-25(31)22(9-4-2)18-20-10-6-5-7-11-20/h3-7,10-11,21-22,28H,1-2,8-9,12-19H2,(H,26,29)(H,27,30) |
| InChIKey | LYDKGKARWPKZRH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|