C33H42N2O8 — CID 135739016
[(2R)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] (2R)-2-benzylpent-4-enoate (PubChem CID 135739016) has the molecular formula C33H42N2O8 and a molecular weight of 594.71 g/mol. Its IUPAC name is [(2R)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] (2R)-2-benzylpent-4-enoate.
| Compound Name | [(2R)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] (2R)-2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 135739016 |
| Molecular Formula | C33H42N2O8 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | [(2R)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] (2R)-2-benzylpent-4-enoate |
| SMILES | C=CC[C@@H](CC(=O)NCCOCCO)C(=O)N[C@H](COC(=O)[C@H](CC=C)Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H42N2O8/c1-3-11-27(22-30(37)34-17-19-41-20-18-36)31(38)35-29(33(40)42-23-26-15-9-6-10-16-26)24-43-32(39)28(12-4-2)21-25-13-7-5-8-14-25/h3-10,13-16,27-29,36H,1-2,11-12,17-24H2,(H,34,37)(H,35,38)/t27-,28+,29+/m0/s1 |
| InChIKey | WKVQYMVSSZSVLC-ZGIBFIJWSA-N |
| XLogP | 2.90 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|