C34H45N3O9 — CID 4065219
[2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate (PubChem CID 4065219) has the molecular formula C34H45N3O9 and a molecular weight of 639.75 g/mol. Its IUPAC name is [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate.
| Compound Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 4065219 |
| Molecular Formula | C34H45N3O9 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate |
| SMILES | C=CCC(CC(=O)NCCOCCO)C(=O)NC(COCc1ccccc1)COC(=O)C(CC=C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H45N3O9/c1-3-11-28(21-31(39)35-17-19-43-20-18-38)32(40)36-29(24-44-22-26-13-7-5-8-14-26)25-45-33(41)30(12-4-2)37-34(42)46-23-27-15-9-6-10-16-27/h3-10,13-16,28-30,38H,1-2,11-12,17-25H2,(H,35,39)(H,36,40)(H,37,42) |
| InChIKey | LBUNKQCNDUBGRK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 161.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|