C32H42N2O6 — CID 6607301
[(2R)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate (PubChem CID 6607301) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is [(2R)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate.
| Compound Name | [(2R)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 6607301 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | [(2R)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate |
| SMILES | C=CC[C@H](CC(=O)NCCOCCO)C(=O)N[C@@H](COC(=O)[C@H](CC=C)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H42N2O6/c1-3-11-27(23-30(36)33-17-19-39-20-18-35)31(37)34-29(22-26-15-9-6-10-16-26)24-40-32(38)28(12-4-2)21-25-13-7-5-8-14-25/h3-10,13-16,27-29,35H,1-2,11-12,17-24H2,(H,33,36)(H,34,37)/t27-,28-,29-/m1/s1 |
| InChIKey | JXEZDTGQDWTGAP-MPFGFTFXSA-N |
| XLogP | 3.40 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|