C37H44N2O5 — CID 4248548
[2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylpropyl] 2-benzylpent-4-enoate (PubChem CID 4248548) has the molecular formula C37H44N2O5 and a molecular weight of 596.77 g/mol. Its IUPAC name is [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylpropyl] 2-benzylpent-4-enoate.
| Compound Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylpropyl] 2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 4248548 |
| Molecular Formula | C37H44N2O5 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylpropyl] 2-benzylpent-4-enoate |
| SMILES | C=CCC(CC(=O)NC(CO)Cc1ccccc1)C(=O)NC(COC(=O)C(CC=C)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H44N2O5/c1-3-14-31(25-35(41)38-33(26-40)23-29-18-10-6-11-19-29)36(42)39-34(24-30-20-12-7-13-21-30)27-44-37(43)32(15-4-2)22-28-16-8-5-9-17-28/h3-13,16-21,31-34,40H,1-2,14-15,22-27H2,(H,38,41)(H,39,42) |
| InChIKey | PCXPCUHECDKBDI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|