C38H46N2O5 — CID 3700996
[2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate (PubChem CID 3700996) has the molecular formula C38H46N2O5 and a molecular weight of 610.80 g/mol. Its IUPAC name is [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate.
| Compound Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 3700996 |
| Molecular Formula | C38H46N2O5 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate |
| SMILES | C=CCCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NC(CO)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H46N2O5/c1-3-5-9-23-33(24-29-17-10-6-11-18-29)38(44)45-28-35(31-21-14-8-15-22-31)40-37(43)32(16-4-2)26-36(42)39-34(27-41)25-30-19-12-7-13-20-30/h3-4,6-8,10-15,17-22,32-35,41H,1-2,5,9,16,23-28H2,(H,39,42)(H,40,43) |
| InChIKey | XBXLWWHDKLTDOH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|