C24H30N2O4 — CID 4178309
N-(2-hydroxy-1-phenylethyl)-N'-(1-hydroxy-3-phenylpropan-2-yl)-2-prop-2-enylbutanediamide (PubChem CID 4178309) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenylethyl)-N'-(1-hydroxy-3-phenylpropan-2-yl)-2-prop-2-enylbutanediamide.
| Compound Name | N-(2-hydroxy-1-phenylethyl)-N'-(1-hydroxy-3-phenylpropan-2-yl)-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 4178309 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-(2-hydroxy-1-phenylethyl)-N'-(1-hydroxy-3-phenylpropan-2-yl)-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(CC(=O)NC(CO)Cc1ccccc1)C(=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O4/c1-2-9-20(24(30)26-22(17-28)19-12-7-4-8-13-19)15-23(29)25-21(16-27)14-18-10-5-3-6-11-18/h2-8,10-13,20-22,27-28H,1,9,14-17H2,(H,25,29)(H,26,30) |
| InChIKey | FZDMYKPWFZWCEM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|