C36H50N2O5 — CID 6605783
[(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3,3-dimethylbutyl] (2R)-2-benzylhept-6-enoate (PubChem CID 6605783) has the molecular formula C36H50N2O5 and a molecular weight of 590.81 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3,3-dimethylbutyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3,3-dimethylbutyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6605783 |
| Molecular Formula | C36H50N2O5 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3,3-dimethylbutyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OC[C@@H](NC(=O)[C@H](CC=C)CC(=O)N[C@@H](CO)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H50N2O5/c1-6-8-11-21-30(22-27-17-12-9-13-18-27)35(42)43-26-32(36(3,4)5)38-34(41)29(16-7-2)24-33(40)37-31(25-39)23-28-19-14-10-15-20-28/h6-7,9-10,12-15,17-20,29-32,39H,1-2,8,11,16,21-26H2,3-5H3,(H,37,40)(H,38,41)/t29-,30-,31-,32-/m1/s1 |
| InChIKey | MVLIJSPGMCKMJV-SEVDZJIVSA-N |
| XLogP | 5.58 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|