C35H48N2O5 — CID 3676073
[2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3,3-dimethylbutyl] 2-benzylhex-5-enoate (PubChem CID 3676073) has the molecular formula C35H48N2O5 and a molecular weight of 576.78 g/mol. Its IUPAC name is [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3,3-dimethylbutyl] 2-benzylhex-5-enoate.
| Compound Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3,3-dimethylbutyl] 2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 3676073 |
| Molecular Formula | C35H48N2O5 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3,3-dimethylbutyl] 2-benzylhex-5-enoate |
| SMILES | C=CCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NC(CO)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H48N2O5/c1-6-8-20-29(21-26-16-11-9-12-17-26)34(41)42-25-31(35(3,4)5)37-33(40)28(15-7-2)23-32(39)36-30(24-38)22-27-18-13-10-14-19-27/h6-7,9-14,16-19,28-31,38H,1-2,8,15,20-25H2,3-5H3,(H,36,39)(H,37,40) |
| InChIKey | ZMXPJKFALKULOK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|