C43H55N3O7 — CID 6605870
[(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] (2R)-2-benzylhex-5-enoate (PubChem CID 6605870) has the molecular formula C43H55N3O7 and a molecular weight of 725.93 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] (2R)-2-benzylhex-5-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] (2R)-2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 6605870 |
| Molecular Formula | C43H55N3O7 |
| Molecular Weight | 725.93 g/mol |
| Exact Mass | 725.40 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] (2R)-2-benzylhex-5-enoate |
| SMILES | C=CCC[C@H](Cc1ccccc1)C(=O)OC[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@H](CC=C)CC(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C43H55N3O7/c1-3-5-24-37(27-33-18-9-6-10-19-33)42(50)52-32-38(25-15-16-26-44-43(51)53-31-35-22-13-8-14-23-35)46-41(49)36(17-4-2)29-40(48)45-39(30-47)28-34-20-11-7-12-21-34/h3-4,6-14,18-23,36-39,47H,1-2,5,15-17,24-32H2,(H,44,51)(H,45,48)(H,46,49)/t36-,37-,38+,39-/m1/s1 |
| InChIKey | VKGJRSBWZVSIBH-ZBMOXSJNSA-N |
| XLogP | 6.24 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.93 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|