C29H43N3O7 — CID 6605639
[(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] pent-4-enoate (PubChem CID 6605639) has the molecular formula C29H43N3O7 and a molecular weight of 545.68 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] pent-4-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] pent-4-enoate |
|---|---|
| PubChem CID | 6605639 |
| Molecular Formula | C29H43N3O7 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-6-(phenylmethoxycarbonylamino)hexyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@H](CC=C)CC(=O)N[C@H](C)CO |
| InChI | InChI=1S/C29H43N3O7/c1-4-6-16-27(35)38-21-25(32-28(36)24(12-5-2)18-26(34)31-22(3)19-33)15-10-11-17-30-29(37)39-20-23-13-8-7-9-14-23/h4-5,7-9,13-14,22,24-25,33H,1-2,6,10-12,15-21H2,3H3,(H,30,37)(H,31,34)(H,32,36)/t22-,24-,25+/m1/s1 |
| InChIKey | UPQTUOVLCDKFDC-GPXOXTDOSA-N |
| XLogP | 3.16 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|