C34H51N3O7 — CID 4128004
[2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-6-(phenylmethoxycarbonylamino)hexyl] hept-6-enoate (PubChem CID 4128004) has the molecular formula C34H51N3O7 and a molecular weight of 613.80 g/mol. Its IUPAC name is [2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-6-(phenylmethoxycarbonylamino)hexyl] hept-6-enoate.
| Compound Name | [2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-6-(phenylmethoxycarbonylamino)hexyl] hept-6-enoate |
|---|---|
| PubChem CID | 4128004 |
| Molecular Formula | C34H51N3O7 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | [2-[2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoylamino]-6-(phenylmethoxycarbonylamino)hexyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OCC(CCCCNC(=O)OCc1ccccc1)NC(=O)C(CC=C)CC(=O)NC1(CO)CCCC1 |
| InChI | InChI=1S/C34H51N3O7/c1-3-5-6-10-19-31(40)43-25-29(18-11-14-22-35-33(42)44-24-27-16-8-7-9-17-27)36-32(41)28(15-4-2)23-30(39)37-34(26-38)20-12-13-21-34/h3-4,7-9,16-17,28-29,38H,1-2,5-6,10-15,18-26H2,(H,35,42)(H,36,41)(H,37,39) |
| InChIKey | ONEPSJAKMHQSEC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|