C26H36N2O5 — CID 135739040
[(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] pent-4-enoate (PubChem CID 135739040) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] pent-4-enoate.
| Compound Name | [(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] pent-4-enoate |
|---|---|
| PubChem CID | 135739040 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | [(2S)-2-[[(2S)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@@H](NC(=O)[C@@H](CC=C)CC(=O)NC1(CO)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H36N2O5/c1-3-5-14-24(31)33-18-22(20-12-7-6-8-13-20)27-25(32)21(11-4-2)17-23(30)28-26(19-29)15-9-10-16-26/h3-4,6-8,12-13,21-22,29H,1-2,5,9-11,14-19H2,(H,27,32)(H,28,30)/t21-,22+/m0/s1 |
| InChIKey | BVUCZJXCIBOEDP-FCHUYYIVSA-N |
| XLogP | 3.36 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|