C21H30N2O4 — CID 6606130
(2R)-N'-[1-(hydroxymethyl)cyclopentyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-2-prop-2-enylbutanediamide (PubChem CID 6606130) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (2R)-N'-[1-(hydroxymethyl)cyclopentyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-2-prop-2-enylbutanediamide.
| Compound Name | (2R)-N'-[1-(hydroxymethyl)cyclopentyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 6606130 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (2R)-N'-[1-(hydroxymethyl)cyclopentyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(CC(=O)NC1(CO)CCCC1)C(=O)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O4/c1-2-8-17(13-19(26)23-21(15-25)11-6-7-12-21)20(27)22-18(14-24)16-9-4-3-5-10-16/h2-5,9-10,17-18,24-25H,1,6-8,11-15H2,(H,22,27)(H,23,26)/t17?,18-/m1/s1 |
| InChIKey | YNPNWXYYCNTBIA-QRWMCTBCSA-N |
| XLogP | 1.84 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|