C19H34N2O4 — CID 135739033
(2S)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-N'-[1-(hydroxymethyl)cyclopentyl]-2-prop-2-enylbutanediamide (PubChem CID 135739033) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-N'-[1-(hydroxymethyl)cyclopentyl]-2-prop-2-enylbutanediamide.
| Compound Name | (2S)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-N'-[1-(hydroxymethyl)cyclopentyl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 135739033 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | (2S)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-N'-[1-(hydroxymethyl)cyclopentyl]-2-prop-2-enylbutanediamide |
| SMILES | C=CC[C@@H](CC(=O)NC1(CO)CCCC1)C(=O)N[C@H](CO)C(C)(C)C |
| InChI | InChI=1S/C19H34N2O4/c1-5-8-14(17(25)20-15(12-22)18(2,3)4)11-16(24)21-19(13-23)9-6-7-10-19/h5,14-15,22-23H,1,6-13H2,2-4H3,(H,20,25)(H,21,24)/t14-,15+/m0/s1 |
| InChIKey | FUMLOWDXNYYDGD-LSDHHAIUSA-N |
| XLogP | 1.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|