C18H30N2O4 — CID 6607016
(3R)-N-[1-(hydroxymethyl)cyclopentyl]-3-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]hex-5-enamide (PubChem CID 6607016) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3R)-N-[1-(hydroxymethyl)cyclopentyl]-3-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]hex-5-enamide.
| Compound Name | (3R)-N-[1-(hydroxymethyl)cyclopentyl]-3-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]hex-5-enamide |
|---|---|
| PubChem CID | 6607016 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (3R)-N-[1-(hydroxymethyl)cyclopentyl]-3-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]hex-5-enamide |
| SMILES | C=CC[C@H](CC(=O)NC1(CO)CCCC1)C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C18H30N2O4/c1-2-6-14(17(24)20-10-5-7-15(20)12-21)11-16(23)19-18(13-22)8-3-4-9-18/h2,14-15,21-22H,1,3-13H2,(H,19,23)/t14-,15+/m1/s1 |
| InChIKey | GFAGIQBRRSXLIW-CABCVRRESA-N |
| XLogP | 0.97 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|