C27H38N2O5 — CID 6607413
[(1S)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] hex-5-enoate (PubChem CID 6607413) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is [(1S)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] hex-5-enoate.
| Compound Name | [(1S)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] hex-5-enoate |
|---|---|
| PubChem CID | 6607413 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | [(1S)-2-[[(2R)-2-[2-[[1-(hydroxymethyl)cyclopentyl]amino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@H](CNC(=O)[C@H](CC=C)CC(=O)NC1(CO)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C27H38N2O5/c1-3-5-7-15-25(32)34-23(21-13-8-6-9-14-21)19-28-26(33)22(12-4-2)18-24(31)29-27(20-30)16-10-11-17-27/h3-4,6,8-9,13-14,22-23,30H,1-2,5,7,10-12,15-20H2,(H,28,33)(H,29,31)/t22-,23-/m1/s1 |
| InChIKey | HYJIKJDXMHHKND-DHIUTWEWSA-N |
| XLogP | 3.75 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|