C29H36N2O5 — CID 4304504
[2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] pent-4-enoate (PubChem CID 4304504) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] pent-4-enoate.
| Compound Name | [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] pent-4-enoate |
|---|---|
| PubChem CID | 4304504 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC(CNC(=O)C(CC=C)CC(=O)N(CCO)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36N2O5/c1-3-5-17-28(34)36-26(24-15-10-7-11-16-24)21-30-29(35)25(12-4-2)20-27(33)31(18-19-32)22-23-13-8-6-9-14-23/h3-4,6-11,13-16,25-26,32H,1-2,5,12,17-22H2,(H,30,35) |
| InChIKey | IZKOYSJWRGJPLH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|