C33H42N2O7 — CID 6606425
[(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hept-6-enoate (PubChem CID 6606425) has the molecular formula C33H42N2O7 and a molecular weight of 578.71 g/mol. Its IUPAC name is [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hept-6-enoate.
| Compound Name | [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hept-6-enoate |
|---|---|
| PubChem CID | 6606425 |
| Molecular Formula | C33H42N2O7 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@@H](NC(=O)[C@H](CC=C)CC(=O)N(CCO)Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H42N2O7/c1-3-5-6-13-19-31(38)41-25-29(33(40)42-24-27-17-11-8-12-18-27)34-32(39)28(14-4-2)22-30(37)35(20-21-36)23-26-15-9-7-10-16-26/h3-4,7-12,15-18,28-29,36H,1-2,5-6,13-14,19-25H2,(H,34,39)/t28-,29-/m1/s1 |
| InChIKey | UVYFPLROVYLJIU-FQLXRVMXSA-N |
| XLogP | 4.11 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|