C39H48N2O6 — CID 5175089
[2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate (PubChem CID 5175089) has the molecular formula C39H48N2O6 and a molecular weight of 640.82 g/mol. Its IUPAC name is [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate.
| Compound Name | [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 5175089 |
| Molecular Formula | C39H48N2O6 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate |
| SMILES | C=CCCC(Cc1ccccc1)C(=O)OCC(COCc1ccccc1)NC(=O)C(CC=C)CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C39H48N2O6/c1-3-5-22-35(25-31-16-9-6-10-17-31)39(45)47-30-36(29-46-28-33-20-13-8-14-21-33)40-38(44)34(15-4-2)26-37(43)41(23-24-42)27-32-18-11-7-12-19-32/h3-4,6-14,16-21,34-36,42H,1-2,5,15,22-30H2,(H,40,44) |
| InChIKey | BPLVQESWTJWVER-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|