C32H40N2O7 — CID 6606422
[(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hex-5-enoate (PubChem CID 6606422) has the molecular formula C32H40N2O7 and a molecular weight of 564.68 g/mol. Its IUPAC name is [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hex-5-enoate.
| Compound Name | [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hex-5-enoate |
|---|---|
| PubChem CID | 6606422 |
| Molecular Formula | C32H40N2O7 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-oxo-3-phenylmethoxypropyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)OC[C@@H](NC(=O)[C@H](CC=C)CC(=O)N(CCO)Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H40N2O7/c1-3-5-8-18-30(37)40-24-28(32(39)41-23-26-16-11-7-12-17-26)33-31(38)27(13-4-2)21-29(36)34(19-20-35)22-25-14-9-6-10-15-25/h3-4,6-7,9-12,14-17,27-28,35H,1-2,5,8,13,18-24H2,(H,33,38)/t27-,28-/m1/s1 |
| InChIKey | NCTMLBOHNFJHPQ-VSGBNLITSA-N |
| XLogP | 3.72 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|