C33H44N2O5 — CID 6605350
[(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhept-6-enoate (PubChem CID 6605350) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6605350 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OC[C@H](C)NC(=O)[C@H](CC=C)CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C33H44N2O5/c1-4-6-9-19-30(22-27-15-10-7-11-16-27)33(39)40-25-26(3)34-32(38)29(14-5-2)23-31(37)35(20-21-36)24-28-17-12-8-13-18-28/h4-5,7-8,10-13,15-18,26,29-30,36H,1-2,6,9,14,19-25H2,3H3,(H,34,38)/t26-,29+,30+/m0/s1 |
| InChIKey | MCZBHANDSYSQDK-NPBSGPTKSA-N |
| XLogP | 4.85 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|