C28H42N2O5 — CID 6606395
[(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate (PubChem CID 6606395) has the molecular formula C28H42N2O5 and a molecular weight of 486.65 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate |
|---|---|
| PubChem CID | 6606395 |
| Molecular Formula | C28H42N2O5 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@@H](NC(=O)[C@H](CC=C)CC(=O)N(CCO)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C28H42N2O5/c1-5-7-8-12-16-27(33)35-21-25(22(3)4)29-28(34)24(13-6-2)19-26(32)30(17-18-31)20-23-14-10-9-11-15-23/h5-6,9-11,14-15,22,24-25,31H,1-2,7-8,12-13,16-21H2,3-4H3,(H,29,34)/t24-,25-/m1/s1 |
| InChIKey | UTZFXHDYLMDHBT-JWQCQUIFSA-N |
| XLogP | 4.02 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|