C25H36N2O5 — CID 6606791
[(2S)-1-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] hex-5-enoate (PubChem CID 6606791) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is [(2S)-1-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] hex-5-enoate.
| Compound Name | [(2S)-1-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] hex-5-enoate |
|---|---|
| PubChem CID | 6606791 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | [(2S)-1-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@@H](C)CNC(=O)[C@H](CC=C)CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N2O5/c1-4-6-8-14-24(30)32-20(3)18-26-25(31)22(11-5-2)17-23(29)27(15-16-28)19-21-12-9-7-10-13-21/h4-5,7,9-10,12-13,20,22,28H,1-2,6,8,11,14-19H2,3H3,(H,26,31)/t20-,22+/m0/s1 |
| InChIKey | BSNYQMPRCLPQJP-RBBKRZOGSA-N |
| XLogP | 2.99 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|