C24H34N2O5 — CID 4295583
1-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]propan-2-yl pent-4-enoate (PubChem CID 4295583) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]propan-2-yl pent-4-enoate.
| Compound Name | 1-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]propan-2-yl pent-4-enoate |
|---|---|
| PubChem CID | 4295583 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]propan-2-yl pent-4-enoate |
| SMILES | C=CCCC(=O)OC(C)CNC(=O)C(CC=C)CC(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C24H34N2O5/c1-4-6-13-23(29)31-18(3)16-25-24(30)20(10-5-2)15-22(28)26-21(17-27)14-19-11-8-7-9-12-19/h4-5,7-9,11-12,18,20-21,27H,1-2,6,10,13-17H2,3H3,(H,25,30)(H,26,28) |
| InChIKey | RCRLLMVHCBSLAB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|