C25H36N2O5 — CID 6605348
2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl hept-6-enoate (PubChem CID 6605348) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is 2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl hept-6-enoate.
| Compound Name | 2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl hept-6-enoate |
|---|---|
| PubChem CID | 6605348 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-[[(2R)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl hept-6-enoate |
| SMILES | C=CCCCCC(=O)OCCNC(=O)[C@H](CC=C)CC(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N2O5/c1-3-5-6-10-14-24(30)32-16-15-26-25(31)21(11-4-2)18-23(29)27-22(19-28)17-20-12-8-7-9-13-20/h3-4,7-9,12-13,21-22,28H,1-2,5-6,10-11,14-19H2,(H,26,31)(H,27,29)/t21-,22-/m1/s1 |
| InChIKey | CVSWTZVHMCDBBB-FGZHOGPDSA-N |
| XLogP | 2.69 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|