C40H50N2O6 — CID 6607239
[(1S,2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate (PubChem CID 6607239) has the molecular formula C40H50N2O6 and a molecular weight of 654.85 g/mol. Its IUPAC name is [(1S,2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(1S,2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6607239 |
| Molecular Formula | C40H50N2O6 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | [(1S,2S)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)O[C@@H](c1ccccc1)[C@H](COC)NC(=O)[C@H](CC=C)CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C40H50N2O6/c1-4-6-10-24-35(27-31-18-11-7-12-19-31)40(46)48-38(33-22-15-9-16-23-33)36(30-47-3)41-39(45)34(17-5-2)28-37(44)42(25-26-43)29-32-20-13-8-14-21-32/h4-5,7-9,11-16,18-23,34-36,38,43H,1-2,6,10,17,24-30H2,3H3,(H,41,45)/t34-,35-,36+,38+/m1/s1 |
| InChIKey | DBMRLWACKILLSQ-NYDUWQFHSA-N |
| XLogP | 6.22 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|