C36H48N2O6 — CID 6607229
[(1S,2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate (PubChem CID 6607229) has the molecular formula C36H48N2O6 and a molecular weight of 604.79 g/mol. Its IUPAC name is [(1S,2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(1S,2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6607229 |
| Molecular Formula | C36H48N2O6 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | [(1S,2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)O[C@@H](c1ccccc1)[C@H](COC)NC(=O)[C@H](CC=C)CC(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C36H48N2O6/c1-4-6-9-20-30(23-27-16-10-7-11-17-27)36(42)44-34(28-18-12-8-13-19-28)32(26-43-3)37-35(41)29(15-5-2)24-33(40)38-22-14-21-31(38)25-39/h4-5,7-8,10-13,16-19,29-32,34,39H,1-2,6,9,14-15,20-26H2,3H3,(H,37,41)/t29-,30-,31+,32+,34+/m1/s1 |
| InChIKey | CBQJUCUAMALDJB-KWXXMMNJSA-N |
| XLogP | 5.18 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|