C34H46N2O6 — CID 3551470
[2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methoxy-1-phenylpropyl] 2-benzylhept-6-enoate (PubChem CID 3551470) has the molecular formula C34H46N2O6 and a molecular weight of 578.75 g/mol. Its IUPAC name is [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methoxy-1-phenylpropyl] 2-benzylhept-6-enoate.
| Compound Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methoxy-1-phenylpropyl] 2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 3551470 |
| Molecular Formula | C34H46N2O6 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methoxy-1-phenylpropyl] 2-benzylhept-6-enoate |
| SMILES | C=CCCCC(Cc1ccccc1)C(=O)OC(c1ccccc1)C(COC)NC(=O)C(CC=C)CC(=O)NC(C)CO |
| InChI | InChI=1S/C34H46N2O6/c1-5-7-10-20-29(21-26-16-11-8-12-17-26)34(40)42-32(27-18-13-9-14-19-27)30(24-41-4)36-33(39)28(15-6-2)22-31(38)35-25(3)23-37/h5-6,8-9,11-14,16-19,25,28-30,32,37H,1-2,7,10,15,20-24H2,3-4H3,(H,35,38)(H,36,39) |
| InChIKey | GLHRLGVYCUTBQO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|